C12H9BrF2N3O3- — CID 163661650
[4-(4-bromo-2-fluoroanilino)-5-fluoro-1-methyl-6-oxo-3-pyridinyl]-dioxidoazanium (PubChem CID 163661650) has the molecular formula C12H9BrF2N3O3- and a molecular weight of 361.12 g/mol. Its IUPAC name is [4-(4-bromo-2-fluoroanilino)-5-fluoro-1-methyl-6-oxo-3-pyridinyl]-dioxidoazanium.
| Compound Name | [4-(4-bromo-2-fluoroanilino)-5-fluoro-1-methyl-6-oxo-3-pyridinyl]-dioxidoazanium |
|---|---|
| PubChem CID | 163661650 |
| Molecular Formula | C12H9BrF2N3O3- |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | [4-(4-bromo-2-fluoroanilino)-5-fluoro-1-methyl-6-oxo-3-pyridinyl]-dioxidoazanium |
| SMILES | Cn1cc([NH+]([O-])[O-])c(Nc2ccc(Br)cc2F)c(F)c1=O |
| InChI | InChI=1S/C12H9BrF2N3O3/c1-17-5-9(18(20)21)11(10(15)12(17)19)16-8-3-2-6(13)4-7(8)14/h2-5,16,18H,1H3/q-1 |
| InChIKey | IUXWVOVZEYRJEN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|