C16H16BrF2N5O3 — CID 91504638
4-(4-bromo-2-fluoroanilino)-3-fluoro-5-[5-(2-hydroxyethylimino)oxadiazolidin-2-yl]-1-methylpyridin-2-one (PubChem CID 91504638) has the molecular formula C16H16BrF2N5O3 and a molecular weight of 444.24 g/mol. Its IUPAC name is 4-(4-bromo-2-fluoroanilino)-3-fluoro-5-[5-(2-hydroxyethylimino)oxadiazolidin-2-yl]-1-methylpyridin-2-one.
| Compound Name | 4-(4-bromo-2-fluoroanilino)-3-fluoro-5-[5-(2-hydroxyethylimino)oxadiazolidin-2-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 91504638 |
| Molecular Formula | C16H16BrF2N5O3 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 4-(4-bromo-2-fluoroanilino)-3-fluoro-5-[5-(2-hydroxyethylimino)oxadiazolidin-2-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(N2NC/C(=N\CCO)O2)c(Nc2ccc(Br)cc2F)c(F)c1=O |
| InChI | InChI=1S/C16H16BrF2N5O3/c1-23-8-12(24-21-7-13(27-24)20-4-5-25)15(14(19)16(23)26)22-11-3-2-9(17)6-10(11)18/h2-3,6,8,21-22,25H,4-5,7H2,1H3/b20-13+ |
| InChIKey | YXTDMKMGKLOWDY-DEDYPNTBSA-N |
| XLogP | 1.82 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|