C16H13BrClFN4O5 — CID 59334446
5-(4-bromo-2-fluoroanilino)-6-chloro-3-[(1R)-1,2-dihydroxyethoxy]-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 59334446) has the molecular formula C16H13BrClFN4O5 and a molecular weight of 475.66 g/mol. Its IUPAC name is 5-(4-bromo-2-fluoroanilino)-6-chloro-3-[(1R)-1,2-dihydroxyethoxy]-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(4-bromo-2-fluoroanilino)-6-chloro-3-[(1R)-1,2-dihydroxyethoxy]-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59334446 |
| Molecular Formula | C16H13BrClFN4O5 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 5-(4-bromo-2-fluoroanilino)-6-chloro-3-[(1R)-1,2-dihydroxyethoxy]-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1c(=O)c(Cl)c(Nc2ccc(Br)cc2F)c2c(=O)n(O[C@@H](O)CO)cnc21 |
| InChI | InChI=1S/C16H13BrClFN4O5/c1-22-14-11(15(26)23(6-20-14)28-10(25)5-24)13(12(18)16(22)27)21-9-3-2-7(17)4-8(9)19/h2-4,6,10,21,24-25H,5H2,1H3/t10-/m1/s1 |
| InChIKey | DHWGVEXQEPVLEI-SNVBAGLBSA-N |
| XLogP | 1.13 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|