C16H15FIN5O3 — CID 24966788
3-(2-aminoethoxy)-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24966788) has the molecular formula C16H15FIN5O3 and a molecular weight of 471.23 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 3-(2-aminoethoxy)-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24966788 |
| Molecular Formula | C16H15FIN5O3 |
| Molecular Weight | 471.23 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 3-(2-aminoethoxy)-5-(2-fluoro-4-iodoanilino)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(I)cc2F)c2c(=O)n(OCCN)cnc21 |
| InChI | InChI=1S/C16H15FIN5O3/c1-22-13(24)7-12(21-11-3-2-9(18)6-10(11)17)14-15(22)20-8-23(16(14)25)26-5-4-19/h2-3,6-8,21H,4-5,19H2,1H3 |
| InChIKey | ZCQXYFIJFURMRC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|