C17H16FIN4O3 — CID 143711373
6-(2-aminoethoxy)-4-(2-fluoro-4-iodoanilino)-1-methyl-1,6-naphthyridine-2,5-dione (PubChem CID 143711373) has the molecular formula C17H16FIN4O3 and a molecular weight of 470.24 g/mol. Its IUPAC name is 6-(2-aminoethoxy)-4-(2-fluoro-4-iodoanilino)-1-methyl-1,6-naphthyridine-2,5-dione.
| Compound Name | 6-(2-aminoethoxy)-4-(2-fluoro-4-iodoanilino)-1-methyl-1,6-naphthyridine-2,5-dione |
|---|---|
| PubChem CID | 143711373 |
| Molecular Formula | C17H16FIN4O3 |
| Molecular Weight | 470.24 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 6-(2-aminoethoxy)-4-(2-fluoro-4-iodoanilino)-1-methyl-1,6-naphthyridine-2,5-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(I)cc2F)c2c(=O)n(OCCN)ccc21 |
| InChI | InChI=1S/C17H16FIN4O3/c1-22-14-4-6-23(26-7-5-20)17(25)16(14)13(9-15(22)24)21-12-3-2-10(19)8-11(12)18/h2-4,6,8-9,21H,5,7,20H2,1H3 |
| InChIKey | QRDCJOCVGNSPHC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|