C19H18FIN2O4 — CID 158499829
6-[(2R)-2,3-dihydroxypropyl]-4-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-1,6-naphthyridine-2,5-dione (PubChem CID 158499829) has the molecular formula C19H18FIN2O4 and a molecular weight of 484.27 g/mol. Its IUPAC name is 6-[(2R)-2,3-dihydroxypropyl]-4-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-1,6-naphthyridine-2,5-dione.
| Compound Name | 6-[(2R)-2,3-dihydroxypropyl]-4-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-1,6-naphthyridine-2,5-dione |
|---|---|
| PubChem CID | 158499829 |
| Molecular Formula | C19H18FIN2O4 |
| Molecular Weight | 484.27 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 6-[(2R)-2,3-dihydroxypropyl]-4-[(2-fluoro-4-iodophenyl)methyl]-1-methyl-1,6-naphthyridine-2,5-dione |
| SMILES | Cn1c(=O)cc(Cc2ccc(I)cc2F)c2c(=O)n(C[C@@H](O)CO)ccc21 |
| InChI | InChI=1S/C19H18FIN2O4/c1-22-16-4-5-23(9-14(25)10-24)19(27)18(16)12(7-17(22)26)6-11-2-3-13(21)8-15(11)20/h2-5,7-8,14,24-25H,6,9-10H2,1H3/t14-/m1/s1 |
| InChIKey | MNDWJDPLOOSBCG-CQSZACIVSA-N |
| XLogP | 1.39 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|