C16H16FIN2O3 — CID 58374888
5-acetyl-3-ethyl-6-[(2-fluoro-4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione (PubChem CID 58374888) has the molecular formula C16H16FIN2O3 and a molecular weight of 430.22 g/mol. Its IUPAC name is 5-acetyl-3-ethyl-6-[(2-fluoro-4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-ethyl-6-[(2-fluoro-4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58374888 |
| Molecular Formula | C16H16FIN2O3 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 5-acetyl-3-ethyl-6-[(2-fluoro-4-iodophenyl)methyl]-1-methylpyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c(C(C)=O)c(Cc2ccc(I)cc2F)n(C)c1=O |
| InChI | InChI=1S/C16H16FIN2O3/c1-4-20-15(22)14(9(2)21)13(19(3)16(20)23)7-10-5-6-11(18)8-12(10)17/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | IWNBPDYTTOZUPX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|