C16H16FIN2O3 — CID 58360691
5-[(2-fluoro-4-iodophenyl)methyl]-6-(2-methoxyacetyl)-2,4-dimethylpyridazin-3-one (PubChem CID 58360691) has the molecular formula C16H16FIN2O3 and a molecular weight of 430.22 g/mol. Its IUPAC name is 5-[(2-fluoro-4-iodophenyl)methyl]-6-(2-methoxyacetyl)-2,4-dimethylpyridazin-3-one.
| Compound Name | 5-[(2-fluoro-4-iodophenyl)methyl]-6-(2-methoxyacetyl)-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 58360691 |
| Molecular Formula | C16H16FIN2O3 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 5-[(2-fluoro-4-iodophenyl)methyl]-6-(2-methoxyacetyl)-2,4-dimethylpyridazin-3-one |
| SMILES | COCC(=O)c1nn(C)c(=O)c(C)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C16H16FIN2O3/c1-9-12(6-10-4-5-11(18)7-13(10)17)15(14(21)8-23-3)19-20(2)16(9)22/h4-5,7H,6,8H2,1-3H3 |
| InChIKey | HWZNLADEWCMJJJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|