C21H12F6INO2 — CID 58431569
1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethanone (PubChem CID 58431569) has the molecular formula C21H12F6INO2 and a molecular weight of 551.22 g/mol. Its IUPAC name is 1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethanone.
| Compound Name | 1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethanone |
|---|---|
| PubChem CID | 58431569 |
| Molecular Formula | C21H12F6INO2 |
| Molecular Weight | 551.22 g/mol |
| Exact Mass | 550.98 |
| IUPAC Name | 1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]ethanone |
| SMILES | O=C(COCc1c(F)c(F)c(F)c(F)c1F)c1ccncc1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C21H12F6INO2/c22-15-6-12(28)2-1-10(15)5-11-7-29-4-3-13(11)16(30)9-31-8-14-17(23)19(25)21(27)20(26)18(14)24/h1-4,6-7H,5,8-9H2 |
| InChIKey | OITCAPTUPQGUOF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.22 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|