C18H14F2INO4 — CID 148535878
1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]-2-(2-hydroxyethoxy)ethanone (PubChem CID 148535878) has the molecular formula C18H14F2INO4 and a molecular weight of 473.21 g/mol. Its IUPAC name is 1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]-2-(2-hydroxyethoxy)ethanone.
| Compound Name | 1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]-2-(2-hydroxyethoxy)ethanone |
|---|---|
| PubChem CID | 148535878 |
| Molecular Formula | C18H14F2INO4 |
| Molecular Weight | 473.21 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,3-benzoxazol-6-yl]-2-(2-hydroxyethoxy)ethanone |
| SMILES | O=C(COCCO)c1cc2ocnc2c(F)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C18H14F2INO4/c19-14-6-11(21)2-1-10(14)5-13-12(15(24)8-25-4-3-23)7-16-18(17(13)20)22-9-26-16/h1-2,6-7,9,23H,3-5,8H2 |
| InChIKey | MREVOKSKKROGKW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|