C17H14F2IN3O3 — CID 58300341
1-[8-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]imidazo[1,2-c]pyrimidin-2-yl]-2-(2-hydroxyethoxy)ethanone (PubChem CID 58300341) has the molecular formula C17H14F2IN3O3 and a molecular weight of 473.22 g/mol. Its IUPAC name is 1-[8-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]imidazo[1,2-c]pyrimidin-2-yl]-2-(2-hydroxyethoxy)ethanone.
| Compound Name | 1-[8-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]imidazo[1,2-c]pyrimidin-2-yl]-2-(2-hydroxyethoxy)ethanone |
|---|---|
| PubChem CID | 58300341 |
| Molecular Formula | C17H14F2IN3O3 |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 1-[8-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]imidazo[1,2-c]pyrimidin-2-yl]-2-(2-hydroxyethoxy)ethanone |
| SMILES | O=C(COCCO)c1nc2c(F)cncn2c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C17H14F2IN3O3/c18-12-6-11(20)2-1-10(12)5-14-16(15(25)8-26-4-3-24)22-17-13(19)7-21-9-23(14)17/h1-2,6-7,9,24H,3-5,8H2 |
| InChIKey | AKUSMOSBTAUUNZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|