C18H20FIN2O4 — CID 58368313
5-[(2-fluoro-4-iodophenyl)methyl]-6-[2-[(2S)-2-hydroxypropoxy]acetyl]-2,4-dimethylpyridazin-3-one (PubChem CID 58368313) has the molecular formula C18H20FIN2O4 and a molecular weight of 474.27 g/mol. Its IUPAC name is 5-[(2-fluoro-4-iodophenyl)methyl]-6-[2-[(2S)-2-hydroxypropoxy]acetyl]-2,4-dimethylpyridazin-3-one.
| Compound Name | 5-[(2-fluoro-4-iodophenyl)methyl]-6-[2-[(2S)-2-hydroxypropoxy]acetyl]-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 58368313 |
| Molecular Formula | C18H20FIN2O4 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 5-[(2-fluoro-4-iodophenyl)methyl]-6-[2-[(2S)-2-hydroxypropoxy]acetyl]-2,4-dimethylpyridazin-3-one |
| SMILES | Cc1c(Cc2ccc(I)cc2F)c(C(=O)COC[C@H](C)O)nn(C)c1=O |
| InChI | InChI=1S/C18H20FIN2O4/c1-10(23)8-26-9-16(24)17-14(11(2)18(25)22(3)21-17)6-12-4-5-13(20)7-15(12)19/h4-5,7,10,23H,6,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | XXUCKJYAZXBSLR-JTQLQIEISA-N |
| XLogP | 2.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|