C18H18ClFINO4 — CID 58368295
3-chloro-6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-[(2S)-2-hydroxypropoxy]acetyl]-1-methylpyridin-2-one (PubChem CID 58368295) has the molecular formula C18H18ClFINO4 and a molecular weight of 493.70 g/mol. Its IUPAC name is 3-chloro-6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-[(2S)-2-hydroxypropoxy]acetyl]-1-methylpyridin-2-one.
| Compound Name | 3-chloro-6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-[(2S)-2-hydroxypropoxy]acetyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 58368295 |
| Molecular Formula | C18H18ClFINO4 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 3-chloro-6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-[(2S)-2-hydroxypropoxy]acetyl]-1-methylpyridin-2-one |
| SMILES | C[C@H](O)COCC(=O)c1cc(Cl)c(=O)n(C)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C18H18ClFINO4/c1-10(23)8-26-9-17(24)13-7-14(19)18(25)22(2)16(13)5-11-3-4-12(21)6-15(11)20/h3-4,6-7,10,23H,5,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | KFBZUYKPKGDBGD-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|