C18H16ClF2IO4 — CID 157122660
1-[2-[(2-chloro-4-iodophenyl)methyl]-3,4-difluorophenyl]-2-(2,3-dihydroxypropoxy)ethanone (PubChem CID 157122660) has the molecular formula C18H16ClF2IO4 and a molecular weight of 496.68 g/mol. Its IUPAC name is 1-[2-[(2-chloro-4-iodophenyl)methyl]-3,4-difluorophenyl]-2-(2,3-dihydroxypropoxy)ethanone.
| Compound Name | 1-[2-[(2-chloro-4-iodophenyl)methyl]-3,4-difluorophenyl]-2-(2,3-dihydroxypropoxy)ethanone |
|---|---|
| PubChem CID | 157122660 |
| Molecular Formula | C18H16ClF2IO4 |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | 1-[2-[(2-chloro-4-iodophenyl)methyl]-3,4-difluorophenyl]-2-(2,3-dihydroxypropoxy)ethanone |
| SMILES | O=C(COCC(O)CO)c1ccc(F)c(F)c1Cc1ccc(I)cc1Cl |
| InChI | InChI=1S/C18H16ClF2IO4/c19-15-6-11(22)2-1-10(15)5-14-13(3-4-16(20)18(14)21)17(25)9-26-8-12(24)7-23/h1-4,6,12,23-24H,5,7-9H2 |
| InChIKey | AIDRPOIKTXMDKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|