C18H18ClFINO4 — CID 58196956
3-chloro-6-[(3R)-3,4-dihydroxybutoxy]-2-[(2-fluoro-4-iodophenyl)methyl]benzamide (PubChem CID 58196956) has the molecular formula C18H18ClFINO4 and a molecular weight of 493.70 g/mol. Its IUPAC name is 3-chloro-6-[(3R)-3,4-dihydroxybutoxy]-2-[(2-fluoro-4-iodophenyl)methyl]benzamide.
| Compound Name | 3-chloro-6-[(3R)-3,4-dihydroxybutoxy]-2-[(2-fluoro-4-iodophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58196956 |
| Molecular Formula | C18H18ClFINO4 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 3-chloro-6-[(3R)-3,4-dihydroxybutoxy]-2-[(2-fluoro-4-iodophenyl)methyl]benzamide |
| SMILES | NC(=O)c1c(OCC[C@@H](O)CO)ccc(Cl)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C18H18ClFINO4/c19-14-3-4-16(26-6-5-12(24)9-23)17(18(22)25)13(14)7-10-1-2-11(21)8-15(10)20/h1-4,8,12,23-24H,5-7,9H2,(H2,22,25)/t12-/m1/s1 |
| InChIKey | XZVDJVZLZHVRNJ-GFCCVEGCSA-N |
| XLogP | 2.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|