C21H22F2INO4 — CID 58196893
2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide (PubChem CID 58196893) has the molecular formula C21H22F2INO4 and a molecular weight of 517.31 g/mol. Its IUPAC name is 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide.
| Compound Name | 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58196893 |
| Molecular Formula | C21H22F2INO4 |
| Molecular Weight | 517.31 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 2-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide |
| SMILES | CC1(C)OCC(CCOc2cc(F)cc(Cc3ccc(I)cc3F)c2C(N)=O)O1 |
| InChI | InChI=1S/C21H22F2INO4/c1-21(2)28-11-16(29-21)5-6-27-18-9-14(22)8-13(19(18)20(25)26)7-12-3-4-15(24)10-17(12)23/h3-4,8-10,16H,5-7,11H2,1-2H3,(H2,25,26) |
| InChIKey | DVRYCCOBDXQFLE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|