C19H14F2IN3O2 — CID 58146028
2-[(5-amino-3-pyridinyl)oxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide (PubChem CID 58146028) has the molecular formula C19H14F2IN3O2 and a molecular weight of 481.24 g/mol. Its IUPAC name is 2-[(5-amino-3-pyridinyl)oxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide.
| Compound Name | 2-[(5-amino-3-pyridinyl)oxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58146028 |
| Molecular Formula | C19H14F2IN3O2 |
| Molecular Weight | 481.24 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 2-[(5-amino-3-pyridinyl)oxy]-4-fluoro-6-[(2-fluoro-4-iodophenyl)methyl]benzamide |
| SMILES | NC(=O)c1c(Cc2ccc(I)cc2F)cc(F)cc1Oc1cncc(N)c1 |
| InChI | InChI=1S/C19H14F2IN3O2/c20-12-4-11(3-10-1-2-13(22)6-16(10)21)18(19(24)26)17(5-12)27-15-7-14(23)8-25-9-15/h1-2,4-9H,3,23H2,(H2,24,26) |
| InChIKey | FTFBJOIZNOHWOJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|