C21H24F2IN3O4S — CID 58145897
4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]benzamide (PubChem CID 58145897) has the molecular formula C21H24F2IN3O4S and a molecular weight of 579.41 g/mol. Its IUPAC name is 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]benzamide.
| Compound Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]benzamide |
|---|---|
| PubChem CID | 58145897 |
| Molecular Formula | C21H24F2IN3O4S |
| Molecular Weight | 579.41 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[2-(4-methylsulfonylpiperazin-1-yl)ethoxy]benzamide |
| SMILES | CS(=O)(=O)N1CCN(CCOc2cc(F)cc(Cc3ccc(I)cc3F)c2C(N)=O)CC1 |
| InChI | InChI=1S/C21H24F2IN3O4S/c1-32(29,30)27-6-4-26(5-7-27)8-9-31-19-12-16(22)11-15(20(19)21(25)28)10-14-2-3-17(24)13-18(14)23/h2-3,11-13H,4-10H2,1H3,(H2,25,28) |
| InChIKey | PRLKOUMYUZZIDM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|