C26H24F2INO3 — CID 58146047
4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(5-oxo-6-phenylhexoxy)benzamide (PubChem CID 58146047) has the molecular formula C26H24F2INO3 and a molecular weight of 563.38 g/mol. Its IUPAC name is 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(5-oxo-6-phenylhexoxy)benzamide.
| Compound Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(5-oxo-6-phenylhexoxy)benzamide |
|---|---|
| PubChem CID | 58146047 |
| Molecular Formula | C26H24F2INO3 |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(5-oxo-6-phenylhexoxy)benzamide |
| SMILES | NC(=O)c1c(Cc2ccc(I)cc2F)cc(F)cc1OCCCCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H24F2INO3/c27-20-14-19(13-18-9-10-21(29)16-23(18)28)25(26(30)32)24(15-20)33-11-5-4-8-22(31)12-17-6-2-1-3-7-17/h1-3,6-7,9-10,14-16H,4-5,8,11-13H2,(H2,30,32) |
| InChIKey | JCOLCHCOOUXGQK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|