C19H19F2IN2O2 — CID 58196953
4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(pyrrolidin-3-ylmethoxy)benzamide (PubChem CID 58196953) has the molecular formula C19H19F2IN2O2 and a molecular weight of 472.27 g/mol. Its IUPAC name is 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(pyrrolidin-3-ylmethoxy)benzamide.
| Compound Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(pyrrolidin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 58196953 |
| Molecular Formula | C19H19F2IN2O2 |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-(pyrrolidin-3-ylmethoxy)benzamide |
| SMILES | NC(=O)c1c(Cc2ccc(I)cc2F)cc(F)cc1OCC1CCNC1 |
| InChI | InChI=1S/C19H19F2IN2O2/c20-14-6-13(5-12-1-2-15(22)8-16(12)21)18(19(23)25)17(7-14)26-10-11-3-4-24-9-11/h1-2,6-8,11,24H,3-5,9-10H2,(H2,23,25) |
| InChIKey | ZIRLWYCPGHJTMD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|