C20H21F2IN2O4S — CID 58146014
4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methoxy]benzamide (PubChem CID 58146014) has the molecular formula C20H21F2IN2O4S and a molecular weight of 550.37 g/mol. Its IUPAC name is 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methoxy]benzamide.
| Compound Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 58146014 |
| Molecular Formula | C20H21F2IN2O4S |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 550.02 |
| IUPAC Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methoxy]benzamide |
| SMILES | CS(=O)(=O)N1CCC[C@@H]1COc1cc(F)cc(Cc2ccc(I)cc2F)c1C(N)=O |
| InChI | InChI=1S/C20H21F2IN2O4S/c1-30(27,28)25-6-2-3-16(25)11-29-18-9-14(21)8-13(19(18)20(24)26)7-12-4-5-15(23)10-17(12)22/h4-5,8-10,16H,2-3,6-7,11H2,1H3,(H2,24,26)/t16-/m1/s1 |
| InChIKey | LZHRXWUIIQSYAE-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|