C24H25F2IN4O4S — CID 58145909
4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]methoxy]benzamide (PubChem CID 58145909) has the molecular formula C24H25F2IN4O4S and a molecular weight of 630.46 g/mol. Its IUPAC name is 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]methoxy]benzamide.
| Compound Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 58145909 |
| Molecular Formula | C24H25F2IN4O4S |
| Molecular Weight | 630.46 g/mol |
| Exact Mass | 630.06 |
| IUPAC Name | 4-fluoro-2-[(2-fluoro-4-iodophenyl)methyl]-6-[[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]methoxy]benzamide |
| SMILES | Cn1cnc(S(=O)(=O)N2CCCC(COc3cc(F)cc(Cc4ccc(I)cc4F)c3C(N)=O)C2)c1 |
| InChI | InChI=1S/C24H25F2IN4O4S/c1-30-12-22(29-14-30)36(33,34)31-6-2-3-15(11-31)13-35-21-9-18(25)8-17(23(21)24(28)32)7-16-4-5-19(27)10-20(16)26/h4-5,8-10,12,14-15H,2-3,6-7,11,13H2,1H3,(H2,28,32) |
| InChIKey | VKGOCNNWBHHJCH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|