C19H20F2INO6S — CID 58145904
[(2R)-4-[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]-2-hydroxybutyl] methanesulfonate (PubChem CID 58145904) has the molecular formula C19H20F2INO6S and a molecular weight of 555.34 g/mol. Its IUPAC name is [(2R)-4-[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]-2-hydroxybutyl] methanesulfonate.
| Compound Name | [(2R)-4-[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]-2-hydroxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 58145904 |
| Molecular Formula | C19H20F2INO6S |
| Molecular Weight | 555.34 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | [(2R)-4-[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]-2-hydroxybutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](O)CCOc1cc(F)cc(Cc2ccc(I)cc2F)c1C(N)=O |
| InChI | InChI=1S/C19H20F2INO6S/c1-30(26,27)29-10-15(24)4-5-28-17-8-13(20)7-12(18(17)19(23)25)6-11-2-3-14(22)9-16(11)21/h2-3,7-9,15,24H,4-6,10H2,1H3,(H2,23,25)/t15-/m1/s1 |
| InChIKey | VWQGHRSMQBZPQY-OAHLLOKOSA-N |
| XLogP | 2.37 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|