C19H22F2N2O4S — CID 143881121
4-fluoro-2-(2-fluoro-4-methylanilino)-6-(3-hydroxy-4-methylsulfanyloxybutoxy)benzamide (PubChem CID 143881121) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-methylanilino)-6-(3-hydroxy-4-methylsulfanyloxybutoxy)benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-methylanilino)-6-(3-hydroxy-4-methylsulfanyloxybutoxy)benzamide |
|---|---|
| PubChem CID | 143881121 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-methylanilino)-6-(3-hydroxy-4-methylsulfanyloxybutoxy)benzamide |
| SMILES | CSOCC(O)CCOc1cc(F)cc(Nc2ccc(C)cc2F)c1C(N)=O |
| InChI | InChI=1S/C19H22F2N2O4S/c1-11-3-4-15(14(21)7-11)23-16-8-12(20)9-17(18(16)19(22)25)26-6-5-13(24)10-27-28-2/h3-4,7-9,13,23-24H,5-6,10H2,1-2H3,(H2,22,25) |
| InChIKey | BCISSCJCCFSZGK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|