C17H16F2N2O — CID 176938951
2-cyclopropyl-4-fluoro-6-(2-fluoro-4-methylanilino)benzamide (PubChem CID 176938951) has the molecular formula C17H16F2N2O and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-cyclopropyl-4-fluoro-6-(2-fluoro-4-methylanilino)benzamide.
| Compound Name | 2-cyclopropyl-4-fluoro-6-(2-fluoro-4-methylanilino)benzamide |
|---|---|
| PubChem CID | 176938951 |
| Molecular Formula | C17H16F2N2O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-cyclopropyl-4-fluoro-6-(2-fluoro-4-methylanilino)benzamide |
| SMILES | Cc1ccc(Nc2cc(F)cc(C3CC3)c2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O/c1-9-2-5-14(13(19)6-9)21-15-8-11(18)7-12(10-3-4-10)16(15)17(20)22/h2,5-8,10,21H,3-4H2,1H3,(H2,20,22) |
| InChIKey | DMBRXFVAAYGTRD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |