C19H20F2N2O2 — CID 143702156
ethane;1-[4-fluoro-2-(2-fluoro-4-methylanilino)benzoyl]azetidin-3-one (PubChem CID 143702156) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethane;1-[4-fluoro-2-(2-fluoro-4-methylanilino)benzoyl]azetidin-3-one.
| Compound Name | ethane;1-[4-fluoro-2-(2-fluoro-4-methylanilino)benzoyl]azetidin-3-one |
|---|---|
| PubChem CID | 143702156 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethane;1-[4-fluoro-2-(2-fluoro-4-methylanilino)benzoyl]azetidin-3-one |
| SMILES | CC.Cc1ccc(Nc2cc(F)ccc2C(=O)N2CC(=O)C2)c(F)c1 |
| InChI | InChI=1S/C17H14F2N2O2.C2H6/c1-10-2-5-15(14(19)6-10)20-16-7-11(18)3-4-13(16)17(23)21-8-12(22)9-21;1-2/h2-7,20H,8-9H2,1H3;1-2H3 |
| InChIKey | RKSGUWSAVLEXOT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |