C17H13F3N2O — CID 176938942
3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-prop-1-ynylbenzamide (PubChem CID 176938942) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-prop-1-ynylbenzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-prop-1-ynylbenzamide |
|---|---|
| PubChem CID | 176938942 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-prop-1-ynylbenzamide |
| SMILES | CC#Cc1cc(F)c(F)c(Nc2ccc(C)cc2F)c1C(N)=O |
| InChI | InChI=1S/C17H13F3N2O/c1-3-4-10-8-12(19)15(20)16(14(10)17(21)23)22-13-6-5-9(2)7-11(13)18/h5-8,22H,1-2H3,(H2,21,23) |
| InChIKey | TVSXRSKKRSQYHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|