C18H22FN3O — CID 176938954
ethane;3-(2-fluoro-4-methylanilino)-5-prop-1-ynyl-1,2-dihydropyridine-4-carboxamide (PubChem CID 176938954) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is ethane;3-(2-fluoro-4-methylanilino)-5-prop-1-ynyl-1,2-dihydropyridine-4-carboxamide.
| Compound Name | ethane;3-(2-fluoro-4-methylanilino)-5-prop-1-ynyl-1,2-dihydropyridine-4-carboxamide |
|---|---|
| PubChem CID | 176938954 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | ethane;3-(2-fluoro-4-methylanilino)-5-prop-1-ynyl-1,2-dihydropyridine-4-carboxamide |
| SMILES | CC.CC#CC1=CNCC(Nc2ccc(C)cc2F)=C1C(N)=O |
| InChI | InChI=1S/C16H16FN3O.C2H6/c1-3-4-11-8-19-9-14(15(11)16(18)21)20-13-6-5-10(2)7-12(13)17;1-2/h5-8,19-20H,9H2,1-2H3,(H2,18,21);1-2H3 |
| InChIKey | WWYCARXAWOUHRN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|