C14H15F3N3OP — CID 176938948
5-[difluoro(phosphanyl)methyl]-3-(2-fluoro-4-methylanilino)-1,2-dihydropyridine-4-carboxamide (PubChem CID 176938948) has the molecular formula C14H15F3N3OP and a molecular weight of 329.26 g/mol. Its IUPAC name is 5-[difluoro(phosphanyl)methyl]-3-(2-fluoro-4-methylanilino)-1,2-dihydropyridine-4-carboxamide.
| Compound Name | 5-[difluoro(phosphanyl)methyl]-3-(2-fluoro-4-methylanilino)-1,2-dihydropyridine-4-carboxamide |
|---|---|
| PubChem CID | 176938948 |
| Molecular Formula | C14H15F3N3OP |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 5-[difluoro(phosphanyl)methyl]-3-(2-fluoro-4-methylanilino)-1,2-dihydropyridine-4-carboxamide |
| SMILES | Cc1ccc(NC2=C(C(N)=O)C(C(F)(F)P)=CNC2)c(F)c1 |
| InChI | InChI=1S/C14H15F3N3OP/c1-7-2-3-10(9(15)4-7)20-11-6-19-5-8(14(16,17)22)12(11)13(18)21/h2-5,19-20H,6,22H2,1H3,(H2,18,21) |
| InChIKey | RLUZKFXMQSBMKP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|