C19H18F2N2O4 — CID 76629412
2-(3,4-dihydroxybutoxy)-6-(4-ethynyl-2-fluoroanilino)-4-fluorobenzamide (PubChem CID 76629412) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-(3,4-dihydroxybutoxy)-6-(4-ethynyl-2-fluoroanilino)-4-fluorobenzamide.
| Compound Name | 2-(3,4-dihydroxybutoxy)-6-(4-ethynyl-2-fluoroanilino)-4-fluorobenzamide |
|---|---|
| PubChem CID | 76629412 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(3,4-dihydroxybutoxy)-6-(4-ethynyl-2-fluoroanilino)-4-fluorobenzamide |
| SMILES | C#Cc1ccc(Nc2cc(F)cc(OCCC(O)CO)c2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C19H18F2N2O4/c1-2-11-3-4-15(14(21)7-11)23-16-8-12(20)9-17(18(16)19(22)26)27-6-5-13(25)10-24/h1,3-4,7-9,13,23-25H,5-6,10H2,(H2,22,26) |
| InChIKey | NKRVDZXJCUNCCR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|