C25H29F2IN2O4 — CID 58146060
tert-butyl 3-[[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 58146060) has the molecular formula C25H29F2IN2O4 and a molecular weight of 586.42 g/mol. Its IUPAC name is tert-butyl 3-[[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58146060 |
| Molecular Formula | C25H29F2IN2O4 |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | tert-butyl 3-[[2-carbamoyl-5-fluoro-3-[(2-fluoro-4-iodophenyl)methyl]phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(COc2cc(F)cc(Cc3ccc(I)cc3F)c2C(N)=O)C1 |
| InChI | InChI=1S/C25H29F2IN2O4/c1-25(2,3)34-24(32)30-8-4-5-15(13-30)14-33-21-11-18(26)10-17(22(21)23(29)31)9-16-6-7-19(28)12-20(16)27/h6-7,10-12,15H,4-5,8-9,13-14H2,1-3H3,(H2,29,31) |
| InChIKey | GOMYPLAZNSRRQP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|