C17H17ClFIN2O4 — CID 58368302
4-chloro-6-[(4S)-4,5-dihydroxypentanoyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2-methylpyridazin-3-one (PubChem CID 58368302) has the molecular formula C17H17ClFIN2O4 and a molecular weight of 494.69 g/mol. Its IUPAC name is 4-chloro-6-[(4S)-4,5-dihydroxypentanoyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-6-[(4S)-4,5-dihydroxypentanoyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 58368302 |
| Molecular Formula | C17H17ClFIN2O4 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | 4-chloro-6-[(4S)-4,5-dihydroxypentanoyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(C(=O)CC[C@H](O)CO)c(Cc2ccc(I)cc2F)c(Cl)c1=O |
| InChI | InChI=1S/C17H17ClFIN2O4/c1-22-17(26)15(18)12(6-9-2-3-10(20)7-13(9)19)16(21-22)14(25)5-4-11(24)8-23/h2-3,7,11,23-24H,4-6,8H2,1H3/t11-/m0/s1 |
| InChIKey | FEJRVIOKBSLNPC-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|