C17H17FINO3 — CID 58431489
(4S)-1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-4,5-dihydroxypentan-1-one (PubChem CID 58431489) has the molecular formula C17H17FINO3 and a molecular weight of 429.23 g/mol. Its IUPAC name is (4S)-1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-4,5-dihydroxypentan-1-one.
| Compound Name | (4S)-1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-4,5-dihydroxypentan-1-one |
|---|---|
| PubChem CID | 58431489 |
| Molecular Formula | C17H17FINO3 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | (4S)-1-[3-[(2-fluoro-4-iodophenyl)methyl]-4-pyridinyl]-4,5-dihydroxypentan-1-one |
| SMILES | O=C(CC[C@H](O)CO)c1ccncc1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C17H17FINO3/c18-16-8-13(19)2-1-11(16)7-12-9-20-6-5-15(12)17(23)4-3-14(22)10-21/h1-2,5-6,8-9,14,21-22H,3-4,7,10H2/t14-/m0/s1 |
| InChIKey | QHNFJUVJBBGDOW-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|