C15H15IN2O3S — CID 58431453
3-[(4-iodo-2-methylphenyl)methyl]-N-methylsulfonylpyridine-4-carboxamide (PubChem CID 58431453) has the molecular formula C15H15IN2O3S and a molecular weight of 430.27 g/mol. Its IUPAC name is 3-[(4-iodo-2-methylphenyl)methyl]-N-methylsulfonylpyridine-4-carboxamide.
| Compound Name | 3-[(4-iodo-2-methylphenyl)methyl]-N-methylsulfonylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 58431453 |
| Molecular Formula | C15H15IN2O3S |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 3-[(4-iodo-2-methylphenyl)methyl]-N-methylsulfonylpyridine-4-carboxamide |
| SMILES | Cc1cc(I)ccc1Cc1cnccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C15H15IN2O3S/c1-10-7-13(16)4-3-11(10)8-12-9-17-6-5-14(12)15(19)18-22(2,20)21/h3-7,9H,8H2,1-2H3,(H,18,19) |
| InChIKey | YJEWRJKJFOXBSD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|