C15H11F4IN2O — CID 58431576
3-[(2-fluoro-4-iodophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide (PubChem CID 58431576) has the molecular formula C15H11F4IN2O and a molecular weight of 438.16 g/mol. Its IUPAC name is 3-[(2-fluoro-4-iodophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide.
| Compound Name | 3-[(2-fluoro-4-iodophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58431576 |
| Molecular Formula | C15H11F4IN2O |
| Molecular Weight | 438.16 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 3-[(2-fluoro-4-iodophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccncc1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C15H11F4IN2O/c16-13-6-11(20)2-1-9(13)5-10-7-21-4-3-12(10)14(23)22-8-15(17,18)19/h1-4,6-7H,5,8H2,(H,22,23) |
| InChIKey | YSMWAVLBFCEPGH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|