C15H14FIN2O4 — CID 163863408
N-[(1R)-1,2-dihydroxyethoxy]-3-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide (PubChem CID 163863408) has the molecular formula C15H14FIN2O4 and a molecular weight of 432.19 g/mol. Its IUPAC name is N-[(1R)-1,2-dihydroxyethoxy]-3-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | N-[(1R)-1,2-dihydroxyethoxy]-3-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 163863408 |
| Molecular Formula | C15H14FIN2O4 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | N-[(1R)-1,2-dihydroxyethoxy]-3-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NO[C@@H](O)CO)c1ccncc1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C15H14FIN2O4/c16-13-6-11(17)2-1-9(13)5-10-7-18-4-3-12(10)15(22)19-23-14(21)8-20/h1-4,6-7,14,20-21H,5,8H2,(H,19,22)/t14-/m1/s1 |
| InChIKey | PENRHRSYYWMIPO-CQSZACIVSA-N |
| XLogP | 1.39 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|