C18H15FINO3S — CID 123161844
1-[3-[(2-fluoro-4-iodophenyl)methyl]thieno[3,2-c]pyridin-2-yl]-2-(2-hydroxyethoxy)ethanone (PubChem CID 123161844) has the molecular formula C18H15FINO3S and a molecular weight of 471.29 g/mol. Its IUPAC name is 1-[3-[(2-fluoro-4-iodophenyl)methyl]thieno[3,2-c]pyridin-2-yl]-2-(2-hydroxyethoxy)ethanone.
| Compound Name | 1-[3-[(2-fluoro-4-iodophenyl)methyl]thieno[3,2-c]pyridin-2-yl]-2-(2-hydroxyethoxy)ethanone |
|---|---|
| PubChem CID | 123161844 |
| Molecular Formula | C18H15FINO3S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | 1-[3-[(2-fluoro-4-iodophenyl)methyl]thieno[3,2-c]pyridin-2-yl]-2-(2-hydroxyethoxy)ethanone |
| SMILES | O=C(COCCO)c1sc2ccncc2c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C18H15FINO3S/c19-15-8-12(20)2-1-11(15)7-13-14-9-21-4-3-17(14)25-18(13)16(23)10-24-6-5-22/h1-4,8-9,22H,5-7,10H2 |
| InChIKey | QLTBYHNPZQRFPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|