C17H14ClFIN3O3 — CID 59452200
4-chloro-1-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 59452200) has the molecular formula C17H14ClFIN3O3 and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-chloro-1-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-chloro-1-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59452200 |
| Molecular Formula | C17H14ClFIN3O3 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 4-chloro-1-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NOCCO)c1cc2c(Cl)cncc2n1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C17H14ClFIN3O3/c18-13-7-21-8-16-12(13)6-15(17(25)22-26-4-3-24)23(16)9-10-1-2-11(20)5-14(10)19/h1-2,5-8,24H,3-4,9H2,(H,22,25) |
| InChIKey | RVFSJIRDECBMSZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|