C18H19FINO4S — CID 165042314
5-acetyl-4-ethyl-2-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)thiophene-3-carboxamide (PubChem CID 165042314) has the molecular formula C18H19FINO4S and a molecular weight of 491.32 g/mol. Its IUPAC name is 5-acetyl-4-ethyl-2-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)thiophene-3-carboxamide.
| Compound Name | 5-acetyl-4-ethyl-2-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 165042314 |
| Molecular Formula | C18H19FINO4S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 5-acetyl-4-ethyl-2-[(2-fluoro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)thiophene-3-carboxamide |
| SMILES | CCc1c(C(C)=O)sc(Cc2ccc(I)cc2F)c1C(=O)NOCCO |
| InChI | InChI=1S/C18H19FINO4S/c1-3-13-16(18(24)21-25-7-6-22)15(26-17(13)10(2)23)8-11-4-5-12(20)9-14(11)19/h4-5,9,22H,3,6-8H2,1-2H3,(H,21,24) |
| InChIKey | OICQKDPIPXVQKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|