C18H17ClIN3O4S2 — CID 153076078
6-[(2-chloro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-2-methylsulfanyl-4-oxo-[1,3]thiazolo[5,4-c]pyridine-7-carboxamide (PubChem CID 153076078) has the molecular formula C18H17ClIN3O4S2 and a molecular weight of 565.84 g/mol. Its IUPAC name is 6-[(2-chloro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-2-methylsulfanyl-4-oxo-[1,3]thiazolo[5,4-c]pyridine-7-carboxamide.
| Compound Name | 6-[(2-chloro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-2-methylsulfanyl-4-oxo-[1,3]thiazolo[5,4-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 153076078 |
| Molecular Formula | C18H17ClIN3O4S2 |
| Molecular Weight | 565.84 g/mol |
| Exact Mass | 564.94 |
| IUPAC Name | 6-[(2-chloro-4-iodophenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-2-methylsulfanyl-4-oxo-[1,3]thiazolo[5,4-c]pyridine-7-carboxamide |
| SMILES | CSc1nc2c(C(=O)NOCCO)c(Cc3ccc(I)cc3Cl)n(C)c(=O)c2s1 |
| InChI | InChI=1S/C18H17ClIN3O4S2/c1-23-12(7-9-3-4-10(20)8-11(9)19)13(16(25)22-27-6-5-24)14-15(17(23)26)29-18(21-14)28-2/h3-4,8,24H,5-7H2,1-2H3,(H,22,25) |
| InChIKey | VMIGWTLGBPYZOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.84 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|