C19H19ClN2O5S — CID 148586278
6-[(2-chloro-4-methylsulfanylphenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide (PubChem CID 148586278) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is 6-[(2-chloro-4-methylsulfanylphenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide.
| Compound Name | 6-[(2-chloro-4-methylsulfanylphenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 148586278 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 6-[(2-chloro-4-methylsulfanylphenyl)methyl]-N-(2-hydroxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
| SMILES | CSc1ccc(Cc2c(C(=O)NOCCO)c3occc3c(=O)n2C)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O5S/c1-22-15(9-11-3-4-12(28-2)10-14(11)20)16(18(24)21-27-8-6-23)17-13(19(22)25)5-7-26-17/h3-5,7,10,23H,6,8-9H2,1-2H3,(H,21,24) |
| InChIKey | MZTJIYSGBVGSPG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|