C12H16ClNO2S — CID 114234815
2-[3-chloro-4-(hydroxymethyl)phenyl]sulfanyl-N-propylacetamide (PubChem CID 114234815) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-[3-chloro-4-(hydroxymethyl)phenyl]sulfanyl-N-propylacetamide.
| Compound Name | 2-[3-chloro-4-(hydroxymethyl)phenyl]sulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 114234815 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[3-chloro-4-(hydroxymethyl)phenyl]sulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-2-5-14-12(16)8-17-10-4-3-9(7-15)11(13)6-10/h3-4,6,15H,2,5,7-8H2,1H3,(H,14,16) |
| InChIKey | VNGKAFSJNBSIBX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |