C10H8Cl2N2OS — CID 71995493
N-(cyanomethyl)-2-(3,4-dichlorophenyl)sulfanylacetamide (PubChem CID 71995493) has the molecular formula C10H8Cl2N2OS and a molecular weight of 275.16 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(3,4-dichlorophenyl)sulfanylacetamide.
| Compound Name | N-(cyanomethyl)-2-(3,4-dichlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 71995493 |
| Molecular Formula | C10H8Cl2N2OS |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | N-(cyanomethyl)-2-(3,4-dichlorophenyl)sulfanylacetamide |
| SMILES | N#CCNC(=O)CSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2OS/c11-8-2-1-7(5-9(8)12)16-6-10(15)14-4-3-13/h1-2,5H,4,6H2,(H,14,15) |
| InChIKey | VVLDDHPOZHCKJF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|