C9H6Cl2N2O2 — CID 116819787
(3,4-dichlorophenyl) N-(cyanomethyl)carbamate (PubChem CID 116819787) has the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. Its IUPAC name is (3,4-dichlorophenyl) N-(cyanomethyl)carbamate.
| Compound Name | (3,4-dichlorophenyl) N-(cyanomethyl)carbamate |
|---|---|
| PubChem CID | 116819787 |
| Molecular Formula | C9H6Cl2N2O2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | (3,4-dichlorophenyl) N-(cyanomethyl)carbamate |
| SMILES | N#CCNC(=O)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2N2O2/c10-7-2-1-6(5-8(7)11)15-9(14)13-4-3-12/h1-2,5H,4H2,(H,13,14) |
| InChIKey | YFVFEYRAGBEQQA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|