C9H9ClN2O3S — CID 82365787
2-chloro-5-(2-hydrazinyl-2-oxoethyl)sulfanylbenzoic acid (PubChem CID 82365787) has the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. Its IUPAC name is 2-chloro-5-(2-hydrazinyl-2-oxoethyl)sulfanylbenzoic acid.
| Compound Name | 2-chloro-5-(2-hydrazinyl-2-oxoethyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 82365787 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-chloro-5-(2-hydrazinyl-2-oxoethyl)sulfanylbenzoic acid |
| SMILES | NNC(=O)CSc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H9ClN2O3S/c10-7-2-1-5(3-6(7)9(14)15)16-4-8(13)12-11/h1-3H,4,11H2,(H,12,13)(H,14,15) |
| InChIKey | TVWROIMQXWAJSV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|