C12H8BrClO3S — CID 113371607
5-[(5-bromofuran-2-yl)methylsulfanyl]-2-chlorobenzoic acid (PubChem CID 113371607) has the molecular formula C12H8BrClO3S and a molecular weight of 347.62 g/mol. Its IUPAC name is 5-[(5-bromofuran-2-yl)methylsulfanyl]-2-chlorobenzoic acid.
| Compound Name | 5-[(5-bromofuran-2-yl)methylsulfanyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 113371607 |
| Molecular Formula | C12H8BrClO3S |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 345.91 |
| IUPAC Name | 5-[(5-bromofuran-2-yl)methylsulfanyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(SCc2ccc(Br)o2)ccc1Cl |
| InChI | InChI=1S/C12H8BrClO3S/c13-11-4-1-7(17-11)6-18-8-2-3-10(14)9(5-8)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | ORSRFBXWIZJIDI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |