C13H10ClFO3S — CID 43416943
5-[(3-chloro-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 43416943) has the molecular formula C13H10ClFO3S and a molecular weight of 300.74 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 43416943 |
| Molecular Formula | C13H10ClFO3S |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CSc2ccc(F)c(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C13H10ClFO3S/c1-7-10(13(16)17)4-8(18-7)6-19-9-2-3-12(15)11(14)5-9/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | APDRMBAFVQVPGK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |