C14H13ClO3S — CID 113222013
5-[(4-chlorophenyl)methylsulfanylmethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 113222013) has the molecular formula C14H13ClO3S and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfanylmethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(4-chlorophenyl)methylsulfanylmethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 113222013 |
| Molecular Formula | C14H13ClO3S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfanylmethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CSCc2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C14H13ClO3S/c1-9-13(14(16)17)6-12(18-9)8-19-7-10-2-4-11(15)5-3-10/h2-6H,7-8H2,1H3,(H,16,17) |
| InChIKey | FXHKNONJCMGEHN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |