C11H16O4S — CID 66105718
5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid (PubChem CID 66105718) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 66105718 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-[(3-hydroxy-2-methylpropyl)sulfanylmethyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CSCC(C)CO)cc1C(=O)O |
| InChI | InChI=1S/C11H16O4S/c1-7(4-12)5-16-6-9-3-10(11(13)14)8(2)15-9/h3,7,12H,4-6H2,1-2H3,(H,13,14) |
| InChIKey | HSFPYHYCRBXQTG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |