C10H14O3 — CID 844972
2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid (PubChem CID 844972) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 844972 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-methyl-5-(2-methylpropyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(CC(C)C)cc1C(=O)O |
| InChI | InChI=1S/C10H14O3/c1-6(2)4-8-5-9(10(11)12)7(3)13-8/h5-6H,4H2,1-3H3,(H,11,12) |
| InChIKey | OVBDZKIFGWMIEV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |